C22H30O10 — CID 57181908
(2S,3R,4R,5S,6R)-5-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol (PubChem CID 57181908) has the molecular formula C22H30O10 and a molecular weight of 454.47 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-5-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4R,5S,6R)-5-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57181908 |
| Molecular Formula | C22H30O10 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-5-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-2,3,4,5-tetrol |
| SMILES | OCCOCCOCCO[C@@]1(O)[C@H](O)[C@@H](O)[C@](O)(c2cccc3ccccc23)O[C@@H]1CO |
| InChI | InChI=1S/C22H30O10/c23-8-9-29-10-11-30-12-13-31-22(28)18(14-24)32-21(27,19(25)20(22)26)17-7-3-5-15-4-1-2-6-16(15)17/h1-7,18-20,23-28H,8-14H2/t18-,19-,20-,21+,22-/m1/s1 |
| InChIKey | JPWRHPOEFHFPOP-CSEOROSGSA-N |
| XLogP | -1.17 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|