C31H51NO4Si — CID 57181924
[(9S,10R,13R,14R,17R)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-dimethylcarbamate (PubChem CID 57181924) has the molecular formula C31H51NO4Si and a molecular weight of 529.84 g/mol. Its IUPAC name is [(9S,10R,13R,14R,17R)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-dimethylcarbamate.
| Compound Name | [(9S,10R,13R,14R,17R)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 57181924 |
| Molecular Formula | C31H51NO4Si |
| Molecular Weight | 529.84 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | [(9S,10R,13R,14R,17R)-1-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-dimethylcarbamate |
| SMILES | CC(C=O)[C@H]1CC[C@H]2C3=CC=C4CC(OC(=O)N(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H51NO4Si/c1-20(19-33)24-13-14-25-23-12-11-21-17-22(35-28(34)32(7)8)18-27(36-37(9,10)29(2,3)4)31(21,6)26(23)15-16-30(24,25)5/h11-12,19-20,22,24-27H,13-18H2,1-10H3/t20?,22?,24-,25+,26+,27?,30-,31+/m1/s1 |
| InChIKey | FRRWLSRDYSTPSM-VLAPWMFOSA-N |
| XLogP | 7.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.84 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|