C26H44F2O6 — CID 57181948
methyl 7-[(1R,2R,5S)-2-(5,5-difluoro-4-hydroxyoctyl)-5-hydroxy-1-[(3R)-oxan-3-yl]oxycyclopentyl]hept-5-enoate (PubChem CID 57181948) has the molecular formula C26H44F2O6 and a molecular weight of 490.63 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-2-(5,5-difluoro-4-hydroxyoctyl)-5-hydroxy-1-[(3R)-oxan-3-yl]oxycyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,5S)-2-(5,5-difluoro-4-hydroxyoctyl)-5-hydroxy-1-[(3R)-oxan-3-yl]oxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 57181948 |
| Molecular Formula | C26H44F2O6 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-2-(5,5-difluoro-4-hydroxyoctyl)-5-hydroxy-1-[(3R)-oxan-3-yl]oxycyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(O)CCC[C@@H]1CC[C@H](O)[C@]1(CC=CCCCC(=O)OC)O[C@@H]1CCCOC1 |
| InChI | InChI=1S/C26H44F2O6/c1-3-16-26(27,28)23(30)12-8-10-20-14-15-22(29)25(20,34-21-11-9-18-33-19-21)17-7-5-4-6-13-24(31)32-2/h5,7,20-23,29-30H,3-4,6,8-19H2,1-2H3/t20-,21-,22+,23?,25-/m1/s1 |
| InChIKey | NNFWWMFQOVAZQV-LBTTULPGSA-N |
| XLogP | 4.95 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|