About 4,4-dimethyl-1,3,2-oxathiaphospholane
4,4-dimethyl-1,3,2-oxathiaphospholane (PubChem CID 57182326) has the molecular formula C4H9OPS
and a molecular weight of 136.16 g/mol. Its IUPAC name is 4,4-dimethyl-1,3,2-oxathiaphospholane.
Molecular Properties
| Compound Name | 4,4-dimethyl-1,3,2-oxathiaphospholane |
| PubChem CID | 57182326 |
| Molecular Formula | C4H9OPS |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | 4,4-dimethyl-1,3,2-oxathiaphospholane |
| SMILES | CC1(C)COPS1 |
| InChI | InChI=1S/C4H9OPS/c1-4(2)3-5-6-7-4/h6H,3H2,1-2H3 |
| InChIKey | JNSSLQRBVQKZRH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-1,3,2-oxathiaphospholane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1,3,2-oxathiaphospholane?
The IUPAC name of 4,4-dimethyl-1,3,2-oxathiaphospholane (CID 57182326) is 4,4-dimethyl-1,3,2-oxathiaphospholane.
What is the SMILES notation for 4,4-dimethyl-1,3,2-oxathiaphospholane?
The canonical SMILES for 4,4-dimethyl-1,3,2-oxathiaphospholane is CC1(C)COPS1.
What is the InChIKey of 4,4-dimethyl-1,3,2-oxathiaphospholane?
The InChIKey is JNSSLQRBVQKZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9OPS/c1-4(2)3-5-6-7-4/h6H,3H2,1-2H3.
What are the key properties of 4,4-dimethyl-1,3,2-oxathiaphospholane?
4,4-dimethyl-1,3,2-oxathiaphospholane has a molecular weight of 136.16 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1,3,2-oxathiaphospholane is sourced from PubChem (CID 57182326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).