C16H12O4 — CID 57182416
2-(4-phenylphenyl)-1,3-dioxane-4,6-dione (PubChem CID 57182416) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2-(4-phenylphenyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 57182416 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-(4-phenylphenyl)-1,3-dioxane-4,6-dione |
| SMILES | O=C1CC(=O)OC(c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C16H12O4/c17-14-10-15(18)20-16(19-14)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,16H,10H2 |
| InChIKey | VMESQLXTMJBOTB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|