C20H18N2O5 — CID 57182733
2-(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)-4-oxopentanoic acid (PubChem CID 57182733) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)-4-oxopentanoic acid.
| Compound Name | 2-(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)-4-oxopentanoic acid |
|---|---|
| PubChem CID | 57182733 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-(3-hydroxy-5-oxo-1,2-diphenylpyrazol-4-yl)-4-oxopentanoic acid |
| SMILES | CC(=O)CC(C(=O)O)c1c(O)n(-c2ccccc2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H18N2O5/c1-13(23)12-16(20(26)27)17-18(24)21(14-8-4-2-5-9-14)22(19(17)25)15-10-6-3-7-11-15/h2-11,16,24H,12H2,1H3,(H,26,27) |
| InChIKey | XITFSFFDOGHGMA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |