C7H10N4O2 — CID 57182824
N-(1-hydroxyethyl)-2-(1H-1,2,4-triazol-5-yl)prop-2-enamide (PubChem CID 57182824) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is N-(1-hydroxyethyl)-2-(1H-1,2,4-triazol-5-yl)prop-2-enamide.
| Compound Name | N-(1-hydroxyethyl)-2-(1H-1,2,4-triazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 57182824 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | N-(1-hydroxyethyl)-2-(1H-1,2,4-triazol-5-yl)prop-2-enamide |
| SMILES | C=C(C(=O)NC(C)O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H10N4O2/c1-4(6-8-3-9-11-6)7(13)10-5(2)12/h3,5,12H,1H2,2H3,(H,10,13)(H,8,9,11) |
| InChIKey | NXOGJZRNKUZFMD-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|