C16H18Cl3N3O4 — CID 57182938
2-chloro-N'-(2-chloroacetyl)-N'-[4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]acetohydrazide (PubChem CID 57182938) has the molecular formula C16H18Cl3N3O4 and a molecular weight of 422.70 g/mol. Its IUPAC name is 2-chloro-N'-(2-chloroacetyl)-N'-[4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]acetohydrazide.
| Compound Name | 2-chloro-N'-(2-chloroacetyl)-N'-[4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 57182938 |
| Molecular Formula | C16H18Cl3N3O4 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2-chloro-N'-(2-chloroacetyl)-N'-[4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]acetohydrazide |
| SMILES | CC1(C)CON(Cc2cc(N(NC(=O)CCl)C(=O)CCl)ccc2Cl)C1=O |
| InChI | InChI=1S/C16H18Cl3N3O4/c1-16(2)9-26-21(15(16)25)8-10-5-11(3-4-12(10)19)22(14(24)7-18)20-13(23)6-17/h3-5H,6-9H2,1-2H3,(H,20,23) |
| InChIKey | GCJPFVWHSFBPOG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|