About 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one
5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 57182954) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one |
| PubChem CID | 57182954 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | Nc1cccc(CC2SCNC2=O)c1 |
| InChI | InChI=1S/C10H12N2OS/c11-8-3-1-2-7(4-8)5-9-10(13)12-6-14-9/h1-4,9H,5-6,11H2,(H,12,13) |
| InChIKey | ZXHQYIFSIOUFMT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one?
The IUPAC name of 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one (CID 57182954) is 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one is Nc1cccc(CC2SCNC2=O)c1.
What is the InChIKey of 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one?
The InChIKey is ZXHQYIFSIOUFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c11-8-3-1-2-7(4-8)5-9-10(13)12-6-14-9/h1-4,9H,5-6,11H2,(H,12,13).
What are the key properties of 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one?
5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one has a molecular weight of 208.29 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-aminophenyl)methyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 57182954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).