C10H18O5 — CID 57183077
(2R,4S,5R)-5-but-2-enyl-2-methyloxane-3,3,4,5-tetrol (PubChem CID 57183077) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2R,4S,5R)-5-but-2-enyl-2-methyloxane-3,3,4,5-tetrol.
| Compound Name | (2R,4S,5R)-5-but-2-enyl-2-methyloxane-3,3,4,5-tetrol |
|---|---|
| PubChem CID | 57183077 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (2R,4S,5R)-5-but-2-enyl-2-methyloxane-3,3,4,5-tetrol |
| SMILES | CC=CC[C@@]1(O)CO[C@H](C)C(O)(O)[C@H]1O |
| InChI | InChI=1S/C10H18O5/c1-3-4-5-9(12)6-15-7(2)10(13,14)8(9)11/h3-4,7-8,11-14H,5-6H2,1-2H3/t7-,8+,9-/m1/s1 |
| InChIKey | FONSFYQRVHGIDW-HRDYMLBCSA-N |
| XLogP | -0.86 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|