C16H27N3O2 — CID 57183400
8-ethyl-7,7,9,9-tetramethyl-3-prop-2-enyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 57183400) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 8-ethyl-7,7,9,9-tetramethyl-3-prop-2-enyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-ethyl-7,7,9,9-tetramethyl-3-prop-2-enyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 57183400 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 8-ethyl-7,7,9,9-tetramethyl-3-prop-2-enyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | C=CCN1C(=O)NC2(CC(C)(C)N(CC)C(C)(C)C2)C1=O |
| InChI | InChI=1S/C16H27N3O2/c1-7-9-18-12(20)16(17-13(18)21)10-14(3,4)19(8-2)15(5,6)11-16/h7H,1,8-11H2,2-6H3,(H,17,21) |
| InChIKey | JMSVONTXHULGIH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|