C20H26N2OS2 — CID 57183419
2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2R)-2-(1,3-thiazolidine-3-carbothioyl)pyrrolidin-3-yl]ethanone (PubChem CID 57183419) has the molecular formula C20H26N2OS2 and a molecular weight of 374.58 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2R)-2-(1,3-thiazolidine-3-carbothioyl)pyrrolidin-3-yl]ethanone.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2R)-2-(1,3-thiazolidine-3-carbothioyl)pyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 57183419 |
| Molecular Formula | C20H26N2OS2 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1-[(2R)-2-(1,3-thiazolidine-3-carbothioyl)pyrrolidin-3-yl]ethanone |
| SMILES | O=C(CC1CCc2ccccc2C1)C1CCN[C@H]1C(=S)N1CCSC1 |
| InChI | InChI=1S/C20H26N2OS2/c23-18(12-14-5-6-15-3-1-2-4-16(15)11-14)17-7-8-21-19(17)20(24)22-9-10-25-13-22/h1-4,14,17,19,21H,5-13H2/t14?,17?,19-/m1/s1 |
| InChIKey | FOCSONUYPUDYIT-ITXXBFQVSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|