C18H22O4S — CID 57183569
[3-[deuterio-(4-methylphenyl)methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 57183569) has the molecular formula C18H22O4S and a molecular weight of 335.44 g/mol. Its IUPAC name is [3-[deuterio-(4-methylphenyl)methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [3-[deuterio-(4-methylphenyl)methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 57183569 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | [3-[deuterio-(4-methylphenyl)methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | [2H]C(=C1C(=O)C2(CS(=O)(=O)O)CCC1C2(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22O4S/c1-12-4-6-13(7-5-12)10-14-15-8-9-18(16(14)19,17(15,2)3)11-23(20,21)22/h4-7,10,15H,8-9,11H2,1-3H3,(H,20,21,22)/i10D |
| InChIKey | HVLMKJJACUTNKC-MMIHMFRQSA-N |
| XLogP | 3.27 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|