C18H25BrN2OS — CID 57183809
4-bromo-N-[(2-pyrrolidin-1-yl-3-sulfanylcyclohexyl)methyl]benzamide (PubChem CID 57183809) has the molecular formula C18H25BrN2OS and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-bromo-N-[(2-pyrrolidin-1-yl-3-sulfanylcyclohexyl)methyl]benzamide.
| Compound Name | 4-bromo-N-[(2-pyrrolidin-1-yl-3-sulfanylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 57183809 |
| Molecular Formula | C18H25BrN2OS |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4-bromo-N-[(2-pyrrolidin-1-yl-3-sulfanylcyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1CCCC(S)C1N1CCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H25BrN2OS/c19-15-8-6-13(7-9-15)18(22)20-12-14-4-3-5-16(23)17(14)21-10-1-2-11-21/h6-9,14,16-17,23H,1-5,10-12H2,(H,20,22) |
| InChIKey | LOLVDSOVBIVCMX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|