About [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium
[N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium (PubChem CID 57184226) has the molecular formula C6H11N2O7P2+
and a molecular weight of 285.11 g/mol. Its IUPAC name is [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium.
Molecular Properties
| Compound Name | [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium |
| PubChem CID | 57184226 |
| Molecular Formula | C6H11N2O7P2+ |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium |
| SMILES | CCc1cc(/N=C(\P(=O)(O)O)[P+](O)(O)O)no1 |
| InChI | InChI=1S/C6H10N2O7P2/c1-2-4-3-5(8-15-4)7-6(16(9,10)11)17(12,13)14/h3,9-11H,2H2,1H3,(H-,12,13,14)/p+1/b7-6- |
| InChIKey | KDKGDLVVEWZNCF-SREVYHEPSA-O |
| XLogP | 0.14 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium?
The IUPAC name of [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium (CID 57184226) is [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium.
What is the SMILES notation for [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium?
The canonical SMILES for [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium is CCc1cc(/N=C(\P(=O)(O)O)[P+](O)(O)O)no1.
What is the InChIKey of [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium?
The InChIKey is KDKGDLVVEWZNCF-SREVYHEPSA-O. The full InChI is InChI=1S/C6H10N2O7P2/c1-2-4-3-5(8-15-4)7-6(16(9,10)11)17(12,13)14/h3,9-11H,2H2,1H3,(H-,12,13,14)/p+1/b7-6-.
What are the key properties of [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium?
[N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium has a molecular weight of 285.11 g/mol, XLogP of 0.14, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [N-(5-ethyl-1,2-oxazol-3-yl)-C-phosphonocarbonimidoyl]-trihydroxyphosphanium is sourced from PubChem (CID 57184226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).