C15H23F2NO2 — CID 57184375
9-(2,2-difluoroethenoxy)-N-(2-methylpropyl)nona-2,4-dienamide (PubChem CID 57184375) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is 9-(2,2-difluoroethenoxy)-N-(2-methylpropyl)nona-2,4-dienamide.
| Compound Name | 9-(2,2-difluoroethenoxy)-N-(2-methylpropyl)nona-2,4-dienamide |
|---|---|
| PubChem CID | 57184375 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 9-(2,2-difluoroethenoxy)-N-(2-methylpropyl)nona-2,4-dienamide |
| SMILES | CC(C)CNC(=O)C=CC=CCCCCOC=C(F)F |
| InChI | InChI=1S/C15H23F2NO2/c1-13(2)11-18-15(19)9-7-5-3-4-6-8-10-20-12-14(16)17/h3,5,7,9,12-13H,4,6,8,10-11H2,1-2H3,(H,18,19) |
| InChIKey | YWPUGEDAHCEMPN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|