About 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane
1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane (PubChem CID 57184605) has the molecular formula C8H10Cl4O
and a molecular weight of 263.98 g/mol. Its IUPAC name is 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane.
Molecular Properties
| Compound Name | 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane |
| PubChem CID | 57184605 |
| Molecular Formula | C8H10Cl4O |
| Molecular Weight | 263.98 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane |
| SMILES | ClC1(Cl)CC1COCC1CC1(Cl)Cl |
| InChI | InChI=1S/C8H10Cl4O/c9-7(10)1-5(7)3-13-4-6-2-8(6,11)12/h5-6H,1-4H2 |
| InChIKey | PFMBRQMJIHLKGX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.98 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane?
The IUPAC name of 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane (CID 57184605) is 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane.
What is the SMILES notation for 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane?
The canonical SMILES for 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane is ClC1(Cl)CC1COCC1CC1(Cl)Cl.
What is the InChIKey of 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane?
The InChIKey is PFMBRQMJIHLKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl4O/c9-7(10)1-5(7)3-13-4-6-2-8(6,11)12/h5-6H,1-4H2.
What are the key properties of 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane?
1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane has a molecular weight of 263.98 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-2-[(2,2-dichlorocyclopropyl)methoxymethyl]cyclopropane is sourced from PubChem (CID 57184605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).