C19H15Cl2NO — CID 57184658
4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydrobenzo[h]chromen-2-imine (PubChem CID 57184658) has the molecular formula C19H15Cl2NO and a molecular weight of 344.24 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydrobenzo[h]chromen-2-imine.
| Compound Name | 4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydrobenzo[h]chromen-2-imine |
|---|---|
| PubChem CID | 57184658 |
| Molecular Formula | C19H15Cl2NO |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydrobenzo[h]chromen-2-imine |
| SMILES | [H]/N=C1\CC(c2ccc(Cl)c(Cl)c2)C2=C(O1)c1ccccc1CC2 |
| InChI | InChI=1S/C19H15Cl2NO/c20-16-8-6-12(9-17(16)21)15-10-18(22)23-19-13-4-2-1-3-11(13)5-7-14(15)19/h1-4,6,8-9,15,22H,5,7,10H2/b22-18+ |
| InChIKey | UKGJHNPRMQAWKV-RELWKKBWSA-N |
| XLogP | 5.83 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|