About 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine
6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine (PubChem CID 57185322) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine |
| PubChem CID | 57185322 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine |
| SMILES | c1cc2cnc(C3OCCO3)cc2o1 |
| InChI | InChI=1S/C10H9NO3/c1-2-12-9-5-8(11-6-7(1)9)10-13-3-4-14-10/h1-2,5-6,10H,3-4H2 |
| InChIKey | NGSOQFZGCBAMHA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine?
The IUPAC name of 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine (CID 57185322) is 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine.
What is the SMILES notation for 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine?
The canonical SMILES for 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine is c1cc2cnc(C3OCCO3)cc2o1.
What is the InChIKey of 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine?
The InChIKey is NGSOQFZGCBAMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-2-12-9-5-8(11-6-7(1)9)10-13-3-4-14-10/h1-2,5-6,10H,3-4H2.
What are the key properties of 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine?
6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine has a molecular weight of 191.19 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-dioxolan-2-yl)furo[3,2-c]pyridine is sourced from PubChem (CID 57185322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).