About [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate
[2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate (PubChem CID 57185858) has the molecular formula C12H18N2O4S
and a molecular weight of 286.35 g/mol. Its IUPAC name is [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate.
Molecular Properties
| Compound Name | [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate |
| PubChem CID | 57185858 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCc1cnc(CN(C=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C12H18N2O4S/c1-9(16)17-7-10-5-13-11(19-10)6-14(8-15)18-12(2,3)4/h5,8H,6-7H2,1-4H3 |
| InChIKey | FFAAWGQVQUZOKM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate?
The IUPAC name of [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate (CID 57185858) is [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate.
What is the SMILES notation for [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate?
The canonical SMILES for [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate is CC(=O)OCc1cnc(CN(C=O)OC(C)(C)C)s1.
What is the InChIKey of [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate?
The InChIKey is FFAAWGQVQUZOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4S/c1-9(16)17-7-10-5-13-11(19-10)6-14(8-15)18-12(2,3)4/h5,8H,6-7H2,1-4H3.
What are the key properties of [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate?
[2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate has a molecular weight of 286.35 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[formyl-[(2-methylpropan-2-yl)oxy]amino]methyl]-1,3-thiazol-5-yl]methyl acetate is sourced from PubChem (CID 57185858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).