About 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene
4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene (PubChem CID 57185938) has the molecular formula C14H9F2N2O2S2-
and a molecular weight of 339.37 g/mol. Its IUPAC name is 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene.
Molecular Properties
| Compound Name | 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene |
| PubChem CID | 57185938 |
| Molecular Formula | C14H9F2N2O2S2- |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene |
| SMILES | N#Cc1ccc(NS(=O)[O-])c(CSc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H10F2N2O2S2/c15-11-2-4-14(12(16)6-11)21-8-10-5-9(7-17)1-3-13(10)18-22(19)20/h1-6,18H,8H2,(H,19,20)/p-1 |
| InChIKey | HRGAFIBCPZAPQG-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene?
The IUPAC name of 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene (CID 57185938) is 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene.
What is the SMILES notation for 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene?
The canonical SMILES for 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene is N#Cc1ccc(NS(=O)[O-])c(CSc2ccc(F)cc2F)c1.
What is the InChIKey of 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene?
The InChIKey is HRGAFIBCPZAPQG-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H10F2N2O2S2/c15-11-2-4-14(12(16)6-11)21-8-10-5-9(7-17)1-3-13(10)18-22(19)20/h1-6,18H,8H2,(H,19,20)/p-1.
What are the key properties of 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene?
4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene has a molecular weight of 339.37 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2-[(2,4-difluorophenyl)sulfanylmethyl]-1-(sulfinatoamino)benzene is sourced from PubChem (CID 57185938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).