About 2,3,4-triethylazete
2,3,4-triethylazete (PubChem CID 57185997) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 2,3,4-triethylazete.
Molecular Properties
| Compound Name | 2,3,4-triethylazete |
| PubChem CID | 57185997 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2,3,4-triethylazete |
| SMILES | CCC1=NC(CC)=C1CC |
| InChI | InChI=1S/C9H15N/c1-4-7-8(5-2)10-9(7)6-3/h4-6H2,1-3H3 |
| InChIKey | UDWQJDUBTLFEHD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4-triethylazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-triethylazete?
The IUPAC name of 2,3,4-triethylazete (CID 57185997) is 2,3,4-triethylazete.
What is the SMILES notation for 2,3,4-triethylazete?
The canonical SMILES for 2,3,4-triethylazete is CCC1=NC(CC)=C1CC.
What is the InChIKey of 2,3,4-triethylazete?
The InChIKey is UDWQJDUBTLFEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-4-7-8(5-2)10-9(7)6-3/h4-6H2,1-3H3.
What are the key properties of 2,3,4-triethylazete?
2,3,4-triethylazete has a molecular weight of 137.23 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-triethylazete is sourced from PubChem (CID 57185997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).