C25H24F4N4O2 — CID 57186021
N-[1,5-bis[4-(difluoromethoxy)phenyl]penta-1,4-dien-3-ylideneamino]-5,7-diazaspiro[2.5]oct-6-en-6-amine (PubChem CID 57186021) has the molecular formula C25H24F4N4O2 and a molecular weight of 488.49 g/mol. Its IUPAC name is N-[1,5-bis[4-(difluoromethoxy)phenyl]penta-1,4-dien-3-ylideneamino]-5,7-diazaspiro[2.5]oct-6-en-6-amine.
| Compound Name | N-[1,5-bis[4-(difluoromethoxy)phenyl]penta-1,4-dien-3-ylideneamino]-5,7-diazaspiro[2.5]oct-6-en-6-amine |
|---|---|
| PubChem CID | 57186021 |
| Molecular Formula | C25H24F4N4O2 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | N-[1,5-bis[4-(difluoromethoxy)phenyl]penta-1,4-dien-3-ylideneamino]-5,7-diazaspiro[2.5]oct-6-en-6-amine |
| SMILES | FC(F)Oc1ccc(C=CC(C=Cc2ccc(OC(F)F)cc2)=NNC2=NCC3(CC3)CN2)cc1 |
| InChI | InChI=1S/C25H24F4N4O2/c26-22(27)34-20-9-3-17(4-10-20)1-7-19(32-33-24-30-15-25(13-14-25)16-31-24)8-2-18-5-11-21(12-6-18)35-23(28)29/h1-12,22-23H,13-16H2,(H2,30,31,33) |
| InChIKey | YIKHEAWEHOCEQG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|