About 2-methoxypropane-1,1-dithiol
2-methoxypropane-1,1-dithiol (PubChem CID 57186055) has the molecular formula C4H10OS2
and a molecular weight of 138.26 g/mol. Its IUPAC name is 2-methoxypropane-1,1-dithiol.
Molecular Properties
| Compound Name | 2-methoxypropane-1,1-dithiol |
| PubChem CID | 57186055 |
| Molecular Formula | C4H10OS2 |
| Molecular Weight | 138.26 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 2-methoxypropane-1,1-dithiol |
| SMILES | COC(C)C(S)S |
| InChI | InChI=1S/C4H10OS2/c1-3(5-2)4(6)7/h3-4,6-7H,1-2H3 |
| InChIKey | OREMOAOBCCDROQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxypropane-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypropane-1,1-dithiol?
The IUPAC name of 2-methoxypropane-1,1-dithiol (CID 57186055) is 2-methoxypropane-1,1-dithiol.
What is the SMILES notation for 2-methoxypropane-1,1-dithiol?
The canonical SMILES for 2-methoxypropane-1,1-dithiol is COC(C)C(S)S.
What is the InChIKey of 2-methoxypropane-1,1-dithiol?
The InChIKey is OREMOAOBCCDROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10OS2/c1-3(5-2)4(6)7/h3-4,6-7H,1-2H3.
What are the key properties of 2-methoxypropane-1,1-dithiol?
2-methoxypropane-1,1-dithiol has a molecular weight of 138.26 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypropane-1,1-dithiol is sourced from PubChem (CID 57186055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).