C28H52O4Si — CID 57186194
2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R,5S)-5-hydroxy-1-methyl-2-propylcyclopent-2-en-1-yl]heptanoic acid (PubChem CID 57186194) has the molecular formula C28H52O4Si and a molecular weight of 480.81 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R,5S)-5-hydroxy-1-methyl-2-propylcyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R,5S)-5-hydroxy-1-methyl-2-propylcyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57186194 |
| Molecular Formula | C28H52O4Si |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R,5S)-5-hydroxy-1-methyl-2-propylcyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CCCC1=CC[C@H](O)[C@]1(C)CCCCCC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C28H52O4Si/c1-8-15-22-18-19-24(29)27(22,5)20-13-10-14-21-28(25(30)31,23-16-11-9-12-17-23)32-33(6,7)26(2,3)4/h18,23-24,29H,8-17,19-21H2,1-7H3,(H,30,31)/t24-,27+,28?/m0/s1 |
| InChIKey | XBGRUAKYYQIORP-LSSUXWNUSA-N |
| XLogP | 7.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|