C25H42O3 — CID 57186255
1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-10-methylundec-9-en-1-one (PubChem CID 57186255) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-10-methylundec-9-en-1-one.
| Compound Name | 1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-10-methylundec-9-en-1-one |
|---|---|
| PubChem CID | 57186255 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 1-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-10-methylundec-9-en-1-one |
| SMILES | CC(C)=CCCCCCCCC(=O)[C@@H]1[C@@H]2CC(CCCCCO)=C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C25H42O3/c1-19(2)12-8-5-3-4-6-10-14-23(27)25-22-17-20(13-9-7-11-15-26)16-21(22)18-24(25)28/h12,16,21-22,24-26,28H,3-11,13-15,17-18H2,1-2H3/t21-,22-,24-,25+/m1/s1 |
| InChIKey | UIERIEKXGZITIA-MFYODDQASA-N |
| XLogP | 5.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|