C33H47NO4Si — CID 57186267
methyl (3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentene-1-carboxylate (PubChem CID 57186267) has the molecular formula C33H47NO4Si and a molecular weight of 549.83 g/mol. Its IUPAC name is methyl (3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentene-1-carboxylate.
| Compound Name | methyl (3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 57186267 |
| Molecular Formula | C33H47NO4Si |
| Molecular Weight | 549.83 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | methyl (3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentene-1-carboxylate |
| SMILES | CCC(CC)C[C@H](NC(C)=O)[C@@H]1C=C(C(=O)OC)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H47NO4Si/c1-8-25(9-2)20-31(34-24(3)35)30-22-26(32(36)37-7)21-27(30)23-38-39(33(4,5)6,28-16-12-10-13-17-28)29-18-14-11-15-19-29/h10-19,22,25,27,30-31H,8-9,20-21,23H2,1-7H3,(H,34,35)/t27-,30+,31-/m0/s1 |
| InChIKey | YHUYTHPJLZLLMN-XTHXZNCLSA-N |
| XLogP | 5.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|