C22H38N2O — CID 57186486
1-[4-(aminomethyl)-4-phenylpiperidin-1-yl]decan-2-ol (PubChem CID 57186486) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-4-phenylpiperidin-1-yl]decan-2-ol.
| Compound Name | 1-[4-(aminomethyl)-4-phenylpiperidin-1-yl]decan-2-ol |
|---|---|
| PubChem CID | 57186486 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 1-[4-(aminomethyl)-4-phenylpiperidin-1-yl]decan-2-ol |
| SMILES | CCCCCCCCC(O)CN1CCC(CN)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H38N2O/c1-2-3-4-5-6-10-13-21(25)18-24-16-14-22(19-23,15-17-24)20-11-8-7-9-12-20/h7-9,11-12,21,25H,2-6,10,13-19,23H2,1H3 |
| InChIKey | BXSPQWNCYYQQEU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|