About 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate
1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate (PubChem CID 57186553) has the molecular formula C15H28O6
and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate |
| PubChem CID | 57186553 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate |
| SMILES | CCCCOC(O)CCC(C(=O)OCC)C(=O)OCCC |
| InChI | InChI=1S/C15H28O6/c1-4-7-11-20-13(16)9-8-12(14(17)19-6-3)15(18)21-10-5-2/h12-13,16H,4-11H2,1-3H3 |
| InChIKey | AYHYSQHEIHULBQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate?
The IUPAC name of 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate (CID 57186553) is 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate?
The canonical SMILES for 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate is CCCCOC(O)CCC(C(=O)OCC)C(=O)OCCC.
What is the InChIKey of 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate?
The InChIKey is AYHYSQHEIHULBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O6/c1-4-7-11-20-13(16)9-8-12(14(17)19-6-3)15(18)21-10-5-2/h12-13,16H,4-11H2,1-3H3.
What are the key properties of 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate?
1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate has a molecular weight of 304.38 g/mol, XLogP of 2.03, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-propyl 2-(3-butoxy-3-hydroxypropyl)propanedioate is sourced from PubChem (CID 57186553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).