C16H20F3NO3S — CID 57186970
[(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 57186970) has the molecular formula C16H20F3NO3S and a molecular weight of 363.40 g/mol. Its IUPAC name is [(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 57186970 |
| Molecular Formula | C16H20F3NO3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CCC[C@H]1CN(S(C)(=O)=O)CC1C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO3S/c1-3-4-12-9-20(24(2,22)23)10-14(12)15(21)11-5-7-13(8-6-11)16(17,18)19/h5-8,12,14H,3-4,9-10H2,1-2H3/t12-,14?/m0/s1 |
| InChIKey | GTVBQCWWDGFRMS-NBFOIZRFSA-N |
| XLogP | 3.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |