About propan-2-yl 4-sulfanylbutanoate
propan-2-yl 4-sulfanylbutanoate (PubChem CID 57187047) has the molecular formula C7H14O2S
and a molecular weight of 162.25 g/mol. Its IUPAC name is propan-2-yl 4-sulfanylbutanoate.
Molecular Properties
| Compound Name | propan-2-yl 4-sulfanylbutanoate |
| PubChem CID | 57187047 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | propan-2-yl 4-sulfanylbutanoate |
| SMILES | CC(C)OC(=O)CCCS |
| InChI | InChI=1S/C7H14O2S/c1-6(2)9-7(8)4-3-5-10/h6,10H,3-5H2,1-2H3 |
| InChIKey | ICROLWMOWNDXNF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-sulfanylbutanoate?
The IUPAC name of propan-2-yl 4-sulfanylbutanoate (CID 57187047) is propan-2-yl 4-sulfanylbutanoate.
What is the SMILES notation for propan-2-yl 4-sulfanylbutanoate?
The canonical SMILES for propan-2-yl 4-sulfanylbutanoate is CC(C)OC(=O)CCCS.
What is the InChIKey of propan-2-yl 4-sulfanylbutanoate?
The InChIKey is ICROLWMOWNDXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2S/c1-6(2)9-7(8)4-3-5-10/h6,10H,3-5H2,1-2H3.
What are the key properties of propan-2-yl 4-sulfanylbutanoate?
propan-2-yl 4-sulfanylbutanoate has a molecular weight of 162.25 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-sulfanylbutanoate is sourced from PubChem (CID 57187047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).