C23H30F2O2 — CID 57187133
(8R,9S,10R,13S,14S)-13-[2-(difluoromethyl)-5-hydroxypent-3-ynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57187133) has the molecular formula C23H30F2O2 and a molecular weight of 376.49 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-13-[2-(difluoromethyl)-5-hydroxypent-3-ynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-13-[2-(difluoromethyl)-5-hydroxypent-3-ynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57187133 |
| Molecular Formula | C23H30F2O2 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (8R,9S,10R,13S,14S)-13-[2-(difluoromethyl)-5-hydroxypent-3-ynyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | O=C1C=C2CC[C@@H]3[C@H](CC[C@]4(CC(C#CCO)C(F)F)CCC[C@@H]34)[C@H]2CC1 |
| InChI | InChI=1S/C23H30F2O2/c24-22(25)16(3-2-12-26)14-23-10-1-4-21(23)20-7-5-15-13-17(27)6-8-18(15)19(20)9-11-23/h13,16,18-22,26H,1,4-12,14H2/t16?,18-,19+,20+,21-,23-/m0/s1 |
| InChIKey | VJCNKNVWWHHDCI-XMSLIMPZSA-N |
| XLogP | 4.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|