C25H25N5S — CID 57187363
5-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]imidazo[1,2-b]pyrazole (PubChem CID 57187363) has the molecular formula C25H25N5S and a molecular weight of 427.58 g/mol. Its IUPAC name is 5-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]imidazo[1,2-b]pyrazole.
| Compound Name | 5-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]imidazo[1,2-b]pyrazole |
|---|---|
| PubChem CID | 57187363 |
| Molecular Formula | C25H25N5S |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 5-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]imidazo[1,2-b]pyrazole |
| SMILES | c1ccc(-c2nc(SCCCCCn3ccc4nccn43)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N5S/c1-4-10-20(11-5-1)23-24(21-12-6-2-7-13-21)28-25(27-23)31-19-9-3-8-16-29-17-14-22-26-15-18-30(22)29/h1-2,4-7,10-15,17-18H,3,8-9,16,19H2,(H,27,28) |
| InChIKey | ZBZZJSCUCNEIGH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|