C20H19N7O2 — CID 57187539
3-N-[(4-nitrophenyl)methyl]-4-N-(2-phenylethyl)-1H-pyrazolo[5,4-d]pyrimidine-3,4-diamine (PubChem CID 57187539) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 3-N-[(4-nitrophenyl)methyl]-4-N-(2-phenylethyl)-1H-pyrazolo[5,4-d]pyrimidine-3,4-diamine.
| Compound Name | 3-N-[(4-nitrophenyl)methyl]-4-N-(2-phenylethyl)-1H-pyrazolo[5,4-d]pyrimidine-3,4-diamine |
|---|---|
| PubChem CID | 57187539 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-N-[(4-nitrophenyl)methyl]-4-N-(2-phenylethyl)-1H-pyrazolo[5,4-d]pyrimidine-3,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(CNc2n[nH]c3ncnc(NCCc4ccccc4)c23)cc1 |
| InChI | InChI=1S/C20H19N7O2/c28-27(29)16-8-6-15(7-9-16)12-22-19-17-18(23-13-24-20(17)26-25-19)21-11-10-14-4-2-1-3-5-14/h1-9,13H,10-12H2,(H3,21,22,23,24,25,26) |
| InChIKey | VFWZNWQNUUMVQB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|