C9H18N2O2 — CID 57187715
(2S,5S)-2,5-diamino-7-methyloctane-3,4-dione (PubChem CID 57187715) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,5S)-2,5-diamino-7-methyloctane-3,4-dione.
| Compound Name | (2S,5S)-2,5-diamino-7-methyloctane-3,4-dione |
|---|---|
| PubChem CID | 57187715 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2S,5S)-2,5-diamino-7-methyloctane-3,4-dione |
| SMILES | CC(C)C[C@H](N)C(=O)C(=O)[C@H](C)N |
| InChI | InChI=1S/C9H18N2O2/c1-5(2)4-7(11)9(13)8(12)6(3)10/h5-7H,4,10-11H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | FXTOGXDBWKHLCO-BQBZGAKWSA-N |
| XLogP | -0.15 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|