C34H44O5 — CID 57187917
3-[2-[4-(2-cyclohexyl-1-ethoxyethoxy)phenyl]ethenyl]-2-(2,2-dimethylpropyl)-5-(4-hydroxyphenyl)penta-2,4-dienoic acid (PubChem CID 57187917) has the molecular formula C34H44O5 and a molecular weight of 532.72 g/mol. Its IUPAC name is 3-[2-[4-(2-cyclohexyl-1-ethoxyethoxy)phenyl]ethenyl]-2-(2,2-dimethylpropyl)-5-(4-hydroxyphenyl)penta-2,4-dienoic acid.
| Compound Name | 3-[2-[4-(2-cyclohexyl-1-ethoxyethoxy)phenyl]ethenyl]-2-(2,2-dimethylpropyl)-5-(4-hydroxyphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 57187917 |
| Molecular Formula | C34H44O5 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 3-[2-[4-(2-cyclohexyl-1-ethoxyethoxy)phenyl]ethenyl]-2-(2,2-dimethylpropyl)-5-(4-hydroxyphenyl)penta-2,4-dienoic acid |
| SMILES | CCOC(CC1CCCCC1)Oc1ccc(C=CC(C=Cc2ccc(O)cc2)=C(CC(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C34H44O5/c1-5-38-32(23-27-9-7-6-8-10-27)39-30-21-15-26(16-22-30)12-18-28(31(33(36)37)24-34(2,3)4)17-11-25-13-19-29(35)20-14-25/h11-22,27,32,35H,5-10,23-24H2,1-4H3,(H,36,37) |
| InChIKey | NRXFVDVBFDMVHX-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|