C31H42N2O2 — CID 57188187
6-methyl-9-[2-(octylamino)-3-phenylpropyl]-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione (PubChem CID 57188187) has the molecular formula C31H42N2O2 and a molecular weight of 474.69 g/mol. Its IUPAC name is 6-methyl-9-[2-(octylamino)-3-phenylpropyl]-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione.
| Compound Name | 6-methyl-9-[2-(octylamino)-3-phenylpropyl]-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
|---|---|
| PubChem CID | 57188187 |
| Molecular Formula | C31H42N2O2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 6-methyl-9-[2-(octylamino)-3-phenylpropyl]-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
| SMILES | CCCCCCCCNC(Cc1ccccc1)CC1CCc2c(C)cc3c(c2C1=O)CCC(=O)N3 |
| InChI | InChI=1S/C31H42N2O2/c1-3-4-5-6-7-11-18-32-25(20-23-12-9-8-10-13-23)21-24-14-15-26-22(2)19-28-27(30(26)31(24)35)16-17-29(34)33-28/h8-10,12-13,19,24-25,32H,3-7,11,14-18,20-21H2,1-2H3,(H,33,34) |
| InChIKey | GLIIHCCBJBVGFM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|