About ethenyl 3-ethenoxypropanoate
ethenyl 3-ethenoxypropanoate (PubChem CID 57188466) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is ethenyl 3-ethenoxypropanoate.
Molecular Properties
| Compound Name | ethenyl 3-ethenoxypropanoate |
| PubChem CID | 57188466 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | ethenyl 3-ethenoxypropanoate |
| SMILES | C=COCCC(=O)OC=C |
| InChI | InChI=1S/C7H10O3/c1-3-9-6-5-7(8)10-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | GMOCJTWTCIHXIZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 3-ethenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 3-ethenoxypropanoate?
The IUPAC name of ethenyl 3-ethenoxypropanoate (CID 57188466) is ethenyl 3-ethenoxypropanoate.
What is the SMILES notation for ethenyl 3-ethenoxypropanoate?
The canonical SMILES for ethenyl 3-ethenoxypropanoate is C=COCCC(=O)OC=C.
What is the InChIKey of ethenyl 3-ethenoxypropanoate?
The InChIKey is GMOCJTWTCIHXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-3-9-6-5-7(8)10-4-2/h3-4H,1-2,5-6H2.
What are the key properties of ethenyl 3-ethenoxypropanoate?
ethenyl 3-ethenoxypropanoate has a molecular weight of 142.15 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 3-ethenoxypropanoate is sourced from PubChem (CID 57188466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).