About 2-chloro-1,3-dihydroindole-2-carboxylic acid
2-chloro-1,3-dihydroindole-2-carboxylic acid (PubChem CID 57188520) has the molecular formula C9H8ClNO2
and a molecular weight of 197.62 g/mol. Its IUPAC name is 2-chloro-1,3-dihydroindole-2-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-1,3-dihydroindole-2-carboxylic acid |
| PubChem CID | 57188520 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 2-chloro-1,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1(Cl)Cc2ccccc2N1 |
| InChI | InChI=1S/C9H8ClNO2/c10-9(8(12)13)5-6-3-1-2-4-7(6)11-9/h1-4,11H,5H2,(H,12,13) |
| InChIKey | LOOGMZOEORTWIZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-dihydroindole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-dihydroindole-2-carboxylic acid?
The IUPAC name of 2-chloro-1,3-dihydroindole-2-carboxylic acid (CID 57188520) is 2-chloro-1,3-dihydroindole-2-carboxylic acid.
What is the SMILES notation for 2-chloro-1,3-dihydroindole-2-carboxylic acid?
The canonical SMILES for 2-chloro-1,3-dihydroindole-2-carboxylic acid is O=C(O)C1(Cl)Cc2ccccc2N1.
What is the InChIKey of 2-chloro-1,3-dihydroindole-2-carboxylic acid?
The InChIKey is LOOGMZOEORTWIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2/c10-9(8(12)13)5-6-3-1-2-4-7(6)11-9/h1-4,11H,5H2,(H,12,13).
What are the key properties of 2-chloro-1,3-dihydroindole-2-carboxylic acid?
2-chloro-1,3-dihydroindole-2-carboxylic acid has a molecular weight of 197.62 g/mol, XLogP of 1.67, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-dihydroindole-2-carboxylic acid is sourced from PubChem (CID 57188520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).