C11H8N4 — CID 57188674
8-phenyl-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 57188674) has the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. Its IUPAC name is 8-phenyl-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 8-phenyl-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 57188674 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 8-phenyl-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | c1ccc(-c2cncn3cnnc23)cc1 |
| InChI | InChI=1S/C11H8N4/c1-2-4-9(5-3-1)10-6-12-7-15-8-13-14-11(10)15/h1-8H |
| InChIKey | VCORNKSCNQZDSU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |