About 5-oxopent-3-enyl cyclopropanecarboxylate
5-oxopent-3-enyl cyclopropanecarboxylate (PubChem CID 57188762) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 5-oxopent-3-enyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | 5-oxopent-3-enyl cyclopropanecarboxylate |
| PubChem CID | 57188762 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5-oxopent-3-enyl cyclopropanecarboxylate |
| SMILES | O=CC=CCCOC(=O)C1CC1 |
| InChI | InChI=1S/C9H12O3/c10-6-2-1-3-7-12-9(11)8-4-5-8/h1-2,6,8H,3-5,7H2 |
| InChIKey | PEFHREKXZVYKHG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-oxopent-3-enyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxopent-3-enyl cyclopropanecarboxylate?
The IUPAC name of 5-oxopent-3-enyl cyclopropanecarboxylate (CID 57188762) is 5-oxopent-3-enyl cyclopropanecarboxylate.
What is the SMILES notation for 5-oxopent-3-enyl cyclopropanecarboxylate?
The canonical SMILES for 5-oxopent-3-enyl cyclopropanecarboxylate is O=CC=CCCOC(=O)C1CC1.
What is the InChIKey of 5-oxopent-3-enyl cyclopropanecarboxylate?
The InChIKey is PEFHREKXZVYKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c10-6-2-1-3-7-12-9(11)8-4-5-8/h1-2,6,8H,3-5,7H2.
What are the key properties of 5-oxopent-3-enyl cyclopropanecarboxylate?
5-oxopent-3-enyl cyclopropanecarboxylate has a molecular weight of 168.19 g/mol, XLogP of 1.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxopent-3-enyl cyclopropanecarboxylate is sourced from PubChem (CID 57188762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).