About 3-prop-2-enyloxiran-2-ol
3-prop-2-enyloxiran-2-ol (PubChem CID 57188836) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is 3-prop-2-enyloxiran-2-ol.
Molecular Properties
| Compound Name | 3-prop-2-enyloxiran-2-ol |
| PubChem CID | 57188836 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | 3-prop-2-enyloxiran-2-ol |
| SMILES | C=CCC1OC1O |
| InChI | InChI=1S/C5H8O2/c1-2-3-4-5(6)7-4/h2,4-6H,1,3H2 |
| InChIKey | HVKXJHLYTDWZPL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enyloxiran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enyloxiran-2-ol?
The IUPAC name of 3-prop-2-enyloxiran-2-ol (CID 57188836) is 3-prop-2-enyloxiran-2-ol.
What is the SMILES notation for 3-prop-2-enyloxiran-2-ol?
The canonical SMILES for 3-prop-2-enyloxiran-2-ol is C=CCC1OC1O.
What is the InChIKey of 3-prop-2-enyloxiran-2-ol?
The InChIKey is HVKXJHLYTDWZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2/c1-2-3-4-5(6)7-4/h2,4-6H,1,3H2.
What are the key properties of 3-prop-2-enyloxiran-2-ol?
3-prop-2-enyloxiran-2-ol has a molecular weight of 100.12 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enyloxiran-2-ol is sourced from PubChem (CID 57188836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).