C10H16O6 — CID 57189007
(1R,6aS,7R,9S,9aS)-7,9-dihydroxy-1-methoxy-6,6a,7,8,9,9a-hexahydro-1H-cyclopenta[e][1,3]dioxocin-5-one (PubChem CID 57189007) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is (1R,6aS,7R,9S,9aS)-7,9-dihydroxy-1-methoxy-6,6a,7,8,9,9a-hexahydro-1H-cyclopenta[e][1,3]dioxocin-5-one.
| Compound Name | (1R,6aS,7R,9S,9aS)-7,9-dihydroxy-1-methoxy-6,6a,7,8,9,9a-hexahydro-1H-cyclopenta[e][1,3]dioxocin-5-one |
|---|---|
| PubChem CID | 57189007 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (1R,6aS,7R,9S,9aS)-7,9-dihydroxy-1-methoxy-6,6a,7,8,9,9a-hexahydro-1H-cyclopenta[e][1,3]dioxocin-5-one |
| SMILES | CO[C@@H]1OCOC(=O)C[C@H]2[C@H]1[C@@H](O)C[C@H]2O |
| InChI | InChI=1S/C10H16O6/c1-14-10-9-5(6(11)3-7(9)12)2-8(13)15-4-16-10/h5-7,9-12H,2-4H2,1H3/t5-,6-,7+,9+,10-/m1/s1 |
| InChIKey | HNHKPAULRPQXID-FOWOUKQUSA-N |
| XLogP | -0.76 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |