C28H44O5 — CID 57189142
methyl 5-[(3aS,4R,5R,6aR)-4-[(4S)-4-methyloct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate (PubChem CID 57189142) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is methyl 5-[(3aS,4R,5R,6aR)-4-[(4S)-4-methyloct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate.
| Compound Name | methyl 5-[(3aS,4R,5R,6aR)-4-[(4S)-4-methyloct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate |
|---|---|
| PubChem CID | 57189142 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | methyl 5-[(3aS,4R,5R,6aR)-4-[(4S)-4-methyloct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate |
| SMILES | CCCC[C@H](C)CC=C[C@@H]1[C@H]2CC(=CCCC(=O)C(=O)OC)C[C@@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C28H44O5/c1-4-5-10-20(2)11-8-13-23-24-18-21(12-9-14-25(29)28(30)31-3)17-22(24)19-26(23)33-27-15-6-7-16-32-27/h8,12-13,20,22-24,26-27H,4-7,9-11,14-19H2,1-3H3/t20-,22+,23+,24-,26+,27?/m0/s1 |
| InChIKey | IZWPWCFTVLLABW-UCSMPFLXSA-N |
| XLogP | 6.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|