About 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate
1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate (PubChem CID 57189263) has the molecular formula C4HCl4NO3
and a molecular weight of 252.87 g/mol. Its IUPAC name is 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate.
Molecular Properties
| Compound Name | 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate |
| PubChem CID | 57189263 |
| Molecular Formula | C4HCl4NO3 |
| Molecular Weight | 252.87 g/mol |
| Exact Mass | 250.87 |
| IUPAC Name | 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate |
| SMILES | O=C=NC(=O)OC(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4HCl4NO3/c5-2(4(6,7)8)12-3(11)9-1-10/h2H |
| InChIKey | PBMTVAZIHGNFFA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.87 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate?
The IUPAC name of 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate (CID 57189263) is 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate.
What is the SMILES notation for 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate?
The canonical SMILES for 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate is O=C=NC(=O)OC(Cl)C(Cl)(Cl)Cl.
What is the InChIKey of 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate?
The InChIKey is PBMTVAZIHGNFFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HCl4NO3/c5-2(4(6,7)8)12-3(11)9-1-10/h2H.
What are the key properties of 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate?
1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate has a molecular weight of 252.87 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2,2-tetrachloroethyl N-(oxomethylidene)carbamate is sourced from PubChem (CID 57189263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).