C33H64F2O4Si2 — CID 57189302
methyl (7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoate (PubChem CID 57189302) has the molecular formula C33H64F2O4Si2 and a molecular weight of 619.04 g/mol. Its IUPAC name is methyl (7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoate.
| Compound Name | methyl (7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoate |
|---|---|
| PubChem CID | 57189302 |
| Molecular Formula | C33H64F2O4Si2 |
| Molecular Weight | 619.04 g/mol |
| Exact Mass | 618.43 |
| IUPAC Name | methyl (7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoate |
| SMILES | CCCC[C@H](F)[C@@H](CC[C@@H]1[C@@H]([C@H](F)C=CCCCC(=O)OC)CC[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H64F2O4Si2/c1-13-14-18-28(35)30(39-41(11,12)33(5,6)7)24-22-26-25(27(34)19-16-15-17-20-31(36)37-8)21-23-29(26)38-40(9,10)32(2,3)4/h16,19,25-30H,13-15,17-18,20-24H2,1-12H3/t25-,26+,27+,28-,29+,30+/m0/s1 |
| InChIKey | ZPEGEULAQDKONM-WFNRLYLRSA-N |
| XLogP | 10.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.04 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|