About 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]
6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (PubChem CID 57189561) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
Molecular Properties
| Compound Name | 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| PubChem CID | 57189561 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| SMILES | CCCCOC12CCC=CC1C(C)C21OCCO1 |
| InChI | InChI=1S/C15H24O3/c1-3-4-9-16-14-8-6-5-7-13(14)12(2)15(14)17-10-11-18-15/h5,7,12-13H,3-4,6,8-11H2,1-2H3 |
| InChIKey | CVURDTVVEOWGSH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The IUPAC name of 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (CID 57189561) is 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
What is the SMILES notation for 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The canonical SMILES for 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] is CCCCOC12CCC=CC1C(C)C21OCCO1.
What is the InChIKey of 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The InChIKey is CVURDTVVEOWGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-3-4-9-16-14-8-6-5-7-13(14)12(2)15(14)17-10-11-18-15/h5,7,12-13H,3-4,6,8-11H2,1-2H3.
What are the key properties of 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] has a molecular weight of 252.35 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-butoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] is sourced from PubChem (CID 57189561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).