About 6-(methoxyamino)octa-2,4,6-trienal
6-(methoxyamino)octa-2,4,6-trienal (PubChem CID 57189673) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-(methoxyamino)octa-2,4,6-trienal.
Molecular Properties
| Compound Name | 6-(methoxyamino)octa-2,4,6-trienal |
| PubChem CID | 57189673 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 6-(methoxyamino)octa-2,4,6-trienal |
| SMILES | CC=C(C=CC=CC=O)NOC |
| InChI | InChI=1S/C9H13NO2/c1-3-9(10-12-2)7-5-4-6-8-11/h3-8,10H,1-2H3 |
| InChIKey | GMSREYBLRKOXCH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-(methoxyamino)octa-2,4,6-trienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxyamino)octa-2,4,6-trienal?
The IUPAC name of 6-(methoxyamino)octa-2,4,6-trienal (CID 57189673) is 6-(methoxyamino)octa-2,4,6-trienal.
What is the SMILES notation for 6-(methoxyamino)octa-2,4,6-trienal?
The canonical SMILES for 6-(methoxyamino)octa-2,4,6-trienal is CC=C(C=CC=CC=O)NOC.
What is the InChIKey of 6-(methoxyamino)octa-2,4,6-trienal?
The InChIKey is GMSREYBLRKOXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-3-9(10-12-2)7-5-4-6-8-11/h3-8,10H,1-2H3.
What are the key properties of 6-(methoxyamino)octa-2,4,6-trienal?
6-(methoxyamino)octa-2,4,6-trienal has a molecular weight of 167.21 g/mol, XLogP of 1.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxyamino)octa-2,4,6-trienal is sourced from PubChem (CID 57189673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).