C20H33BrO3 — CID 57190776
methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate (PubChem CID 57190776) has the molecular formula C20H33BrO3 and a molecular weight of 401.39 g/mol. Its IUPAC name is methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate.
| Compound Name | methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate |
|---|---|
| PubChem CID | 57190776 |
| Molecular Formula | C20H33BrO3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate |
| SMILES | COC(=O)[C@](C)(O)CCC[C@@H](C)[C@H]1CCC2C(=CBr)CCC[C@@]21C |
| InChI | InChI=1S/C20H33BrO3/c1-14(7-5-12-20(3,23)18(22)24-4)16-9-10-17-15(13-21)8-6-11-19(16,17)2/h13-14,16-17,23H,5-12H2,1-4H3/t14-,16-,17?,19-,20-/m1/s1 |
| InChIKey | BPWJMAXRYFOFQA-RGUQHTJGSA-N |
| XLogP | 5.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |