About 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine
2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine (PubChem CID 57190890) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine |
| PubChem CID | 57190890 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine |
| SMILES | NCC(CCc1nccs1)c1ccccn1 |
| InChI | InChI=1S/C12H15N3S/c13-9-10(11-3-1-2-6-14-11)4-5-12-15-7-8-16-12/h1-3,6-8,10H,4-5,9,13H2 |
| InChIKey | ORRNIWMVMQFZMM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine?
The IUPAC name of 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine (CID 57190890) is 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine.
What is the SMILES notation for 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine?
The canonical SMILES for 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine is NCC(CCc1nccs1)c1ccccn1.
What is the InChIKey of 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine?
The InChIKey is ORRNIWMVMQFZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c13-9-10(11-3-1-2-6-14-11)4-5-12-15-7-8-16-12/h1-3,6-8,10H,4-5,9,13H2.
What are the key properties of 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine?
2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine has a molecular weight of 233.34 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-4-(1,3-thiazol-2-yl)butan-1-amine is sourced from PubChem (CID 57190890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).